C19H19ClN2O2S — CID 8726871
(2R)-N-(4-chlorophenyl)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-1-carbothioamide (PubChem CID 8726871) has the molecular formula C19H19ClN2O2S and a molecular weight of 374.89 g/mol. Its IUPAC name is (2R)-N-(4-chlorophenyl)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-1-carbothioamide.
| Compound Name | (2R)-N-(4-chlorophenyl)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 8726871 |
| Molecular Formula | C19H19ClN2O2S |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | (2R)-N-(4-chlorophenyl)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-1-carbothioamide |
| SMILES | S=C(Nc1ccc(Cl)cc1)N1CCC[C@@H]1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H19ClN2O2S/c20-14-4-6-15(7-5-14)21-19(25)22-9-1-2-16(22)13-3-8-17-18(12-13)24-11-10-23-17/h3-8,12,16H,1-2,9-11H2,(H,21,25)/t16-/m1/s1 |
| InChIKey | CPOPWQQOZVGZJR-MRXNPFEDSA-N |
| XLogP | 4.65 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|