C20H18O3S — CID 87268810
4,8,8,8a-tetramethyl-2-phenylthieno[2,3-f][2]benzofuran-5,7-dione (PubChem CID 87268810) has the molecular formula C20H18O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is 4,8,8,8a-tetramethyl-2-phenylthieno[2,3-f][2]benzofuran-5,7-dione.
| Compound Name | 4,8,8,8a-tetramethyl-2-phenylthieno[2,3-f][2]benzofuran-5,7-dione |
|---|---|
| PubChem CID | 87268810 |
| Molecular Formula | C20H18O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 4,8,8,8a-tetramethyl-2-phenylthieno[2,3-f][2]benzofuran-5,7-dione |
| SMILES | CC1=C2C=C(c3ccccc3)SC2(C)C(C)(C)C2=C1C(=O)OC2=O |
| InChI | InChI=1S/C20H18O3S/c1-11-13-10-14(12-8-6-5-7-9-12)24-20(13,4)19(2,3)16-15(11)17(21)23-18(16)22/h5-10H,1-4H3 |
| InChIKey | PLDONYAFCSAXFR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|