About 2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol
2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol (PubChem CID 87268923) has the molecular formula C18H38O4
and a molecular weight of 318.50 g/mol. Its IUPAC name is 2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol.
Molecular Properties
| Compound Name | 2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol |
| PubChem CID | 87268923 |
| Molecular Formula | C18H38O4 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | 2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol |
| SMILES | CC(C)CC(C)CC(CC(C)C)OCCOCCOCCO |
| InChI | InChI=1S/C18H38O4/c1-15(2)12-17(5)14-18(13-16(3)4)22-11-10-21-9-8-20-7-6-19/h15-19H,6-14H2,1-5H3 |
| InChIKey | PLFJWWUZKJKIPZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol?
The IUPAC name of 2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol (CID 87268923) is 2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol.
What is the SMILES notation for 2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol?
The canonical SMILES for 2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol is CC(C)CC(C)CC(CC(C)C)OCCOCCOCCO.
What is the InChIKey of 2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol?
The InChIKey is PLFJWWUZKJKIPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O4/c1-15(2)12-17(5)14-18(13-16(3)4)22-11-10-21-9-8-20-7-6-19/h15-19H,6-14H2,1-5H3.
What are the key properties of 2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol?
2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol has a molecular weight of 318.50 g/mol, XLogP of 3.52, 15 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol is sourced from PubChem (CID 87268923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).