C7H4O5 — CID 87268939
3a,6a-dihydrocyclopenta[c]furan-1,3,4,6-tetrone (PubChem CID 87268939) has the molecular formula C7H4O5 and a molecular weight of 168.10 g/mol. Its IUPAC name is 3a,6a-dihydrocyclopenta[c]furan-1,3,4,6-tetrone.
| Compound Name | 3a,6a-dihydrocyclopenta[c]furan-1,3,4,6-tetrone |
|---|---|
| PubChem CID | 87268939 |
| Molecular Formula | C7H4O5 |
| Molecular Weight | 168.10 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 3a,6a-dihydrocyclopenta[c]furan-1,3,4,6-tetrone |
| SMILES | O=C1CC(=O)C2C(=O)OC(=O)C12 |
| InChI | InChI=1S/C7H4O5/c8-2-1-3(9)5-4(2)6(10)12-7(5)11/h4-5H,1H2 |
| InChIKey | IWJNFPRMGAVRKR-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.10 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|