About methyl-[(1S,5R)-3-(3-methyl-2-oxochromen-7-yl)oxy-8-azabicyclo[3.2.1]octan-8-yl]borinic acid
methyl-[(1S,5R)-3-(3-methyl-2-oxochromen-7-yl)oxy-8-azabicyclo[3.2.1]octan-8-yl]borinic acid (PubChem CID 87268989) has the molecular formula C18H22BNO4
and a molecular weight of 327.19 g/mol. Its IUPAC name is methyl-[(1S,5R)-3-(3-methyl-2-oxochromen-7-yl)oxy-8-azabicyclo[3.2.1]octan-8-yl]borinic acid.
Molecular Properties
| Compound Name | methyl-[(1S,5R)-3-(3-methyl-2-oxochromen-7-yl)oxy-8-azabicyclo[3.2.1]octan-8-yl]borinic acid |
| PubChem CID | 87268989 |
| Molecular Formula | C18H22BNO4 |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | methyl-[(1S,5R)-3-(3-methyl-2-oxochromen-7-yl)oxy-8-azabicyclo[3.2.1]octan-8-yl]borinic acid |
| SMILES | CB(O)N1[C@@H]2CC[C@H]1CC(Oc1ccc3cc(C)c(=O)oc3c1)C2 |
| InChI | InChI=1S/C18H22BNO4/c1-11-7-12-3-6-15(10-17(12)24-18(11)21)23-16-8-13-4-5-14(9-16)20(13)19(2)22/h3,6-7,10,13-14,16,22H,4-5,8-9H2,1-2H3/t13-,14+,16? |
| InChIKey | AYXMGIXMRIDFPT-MZBDJJRSSA-N |
| XLogP | 2.59 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl-[(1S,5R)-3-(3-methyl-2-oxochromen-7-yl)oxy-8-azabicyclo[3.2.1]octan-8-yl]borinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[(1S,5R)-3-(3-methyl-2-oxochromen-7-yl)oxy-8-azabicyclo[3.2.1]octan-8-yl]borinic acid?
The IUPAC name of methyl-[(1S,5R)-3-(3-methyl-2-oxochromen-7-yl)oxy-8-azabicyclo[3.2.1]octan-8-yl]borinic acid (CID 87268989) is methyl-[(1S,5R)-3-(3-methyl-2-oxochromen-7-yl)oxy-8-azabicyclo[3.2.1]octan-8-yl]borinic acid.
What is the SMILES notation for methyl-[(1S,5R)-3-(3-methyl-2-oxochromen-7-yl)oxy-8-azabicyclo[3.2.1]octan-8-yl]borinic acid?
The canonical SMILES for methyl-[(1S,5R)-3-(3-methyl-2-oxochromen-7-yl)oxy-8-azabicyclo[3.2.1]octan-8-yl]borinic acid is CB(O)N1[C@@H]2CC[C@H]1CC(Oc1ccc3cc(C)c(=O)oc3c1)C2.
What is the InChIKey of methyl-[(1S,5R)-3-(3-methyl-2-oxochromen-7-yl)oxy-8-azabicyclo[3.2.1]octan-8-yl]borinic acid?
The InChIKey is AYXMGIXMRIDFPT-MZBDJJRSSA-N. The full InChI is InChI=1S/C18H22BNO4/c1-11-7-12-3-6-15(10-17(12)24-18(11)21)23-16-8-13-4-5-14(9-16)20(13)19(2)22/h3,6-7,10,13-14,16,22H,4-5,8-9H2,1-2H3/t13-,14+,16?.
What are the key properties of methyl-[(1S,5R)-3-(3-methyl-2-oxochromen-7-yl)oxy-8-azabicyclo[3.2.1]octan-8-yl]borinic acid?
methyl-[(1S,5R)-3-(3-methyl-2-oxochromen-7-yl)oxy-8-azabicyclo[3.2.1]octan-8-yl]borinic acid has a molecular weight of 327.19 g/mol, XLogP of 2.59, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[(1S,5R)-3-(3-methyl-2-oxochromen-7-yl)oxy-8-azabicyclo[3.2.1]octan-8-yl]borinic acid is sourced from PubChem (CID 87268989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).