C16H22N2O5 — CID 87269279
1,4-diisocyanato-2,3-dimethylbenzene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 87269279) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is 1,4-diisocyanato-2,3-dimethylbenzene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 1,4-diisocyanato-2,3-dimethylbenzene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 87269279 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1,4-diisocyanato-2,3-dimethylbenzene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | CCC(CO)(CO)CO.Cc1c(N=C=O)ccc(N=C=O)c1C |
| InChI | InChI=1S/C10H8N2O2.C6H14O3/c1-7-8(2)10(12-6-14)4-3-9(7)11-5-13;1-2-6(3-7,4-8)5-9/h3-4H,1-2H3;7-9H,2-5H2,1H3 |
| InChIKey | SXVUYPHJMIBTFU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|