About 5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid;methyl 3-propylsulfanylprop-2-enoate
5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid;methyl 3-propylsulfanylprop-2-enoate (PubChem CID 87270361) has the molecular formula C16H24O6S
and a molecular weight of 344.43 g/mol. Its IUPAC name is 5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid;methyl 3-propylsulfanylprop-2-enoate.
Molecular Properties
| Compound Name | 5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid;methyl 3-propylsulfanylprop-2-enoate |
| PubChem CID | 87270361 |
| Molecular Formula | C16H24O6S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid;methyl 3-propylsulfanylprop-2-enoate |
| SMILES | C=C(CC=C(C)C(=O)O)C(=O)OC.CCCSC=CC(=O)OC |
| InChI | InChI=1S/C9H12O4.C7H12O2S/c1-6(8(10)11)4-5-7(2)9(12)13-3;1-3-5-10-6-4-7(8)9-2/h4H,2,5H2,1,3H3,(H,10,11);4,6H,3,5H2,1-2H3 |
| InChIKey | VDRMAURYLVBOSO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid;methyl 3-propylsulfanylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid;methyl 3-propylsulfanylprop-2-enoate?
The IUPAC name of 5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid;methyl 3-propylsulfanylprop-2-enoate (CID 87270361) is 5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid;methyl 3-propylsulfanylprop-2-enoate.
What is the SMILES notation for 5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid;methyl 3-propylsulfanylprop-2-enoate?
The canonical SMILES for 5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid;methyl 3-propylsulfanylprop-2-enoate is C=C(CC=C(C)C(=O)O)C(=O)OC.CCCSC=CC(=O)OC.
What is the InChIKey of 5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid;methyl 3-propylsulfanylprop-2-enoate?
The InChIKey is VDRMAURYLVBOSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4.C7H12O2S/c1-6(8(10)11)4-5-7(2)9(12)13-3;1-3-5-10-6-4-7(8)9-2/h4H,2,5H2,1,3H3,(H,10,11);4,6H,3,5H2,1-2H3.
What are the key properties of 5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid;methyl 3-propylsulfanylprop-2-enoate?
5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid;methyl 3-propylsulfanylprop-2-enoate has a molecular weight of 344.43 g/mol, XLogP of 2.95, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid;methyl 3-propylsulfanylprop-2-enoate is sourced from PubChem (CID 87270361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).