About (Z)-but-2-enedioic acid;N-prop-2-enylprop-2-en-1-amine;hydrochloride
(Z)-but-2-enedioic acid;N-prop-2-enylprop-2-en-1-amine;hydrochloride (PubChem CID 87270444) has the molecular formula C10H16ClNO4
and a molecular weight of 249.69 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-prop-2-enylprop-2-en-1-amine;hydrochloride.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;N-prop-2-enylprop-2-en-1-amine;hydrochloride |
| PubChem CID | 87270444 |
| Molecular Formula | C10H16ClNO4 |
| Molecular Weight | 249.69 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-prop-2-enylprop-2-en-1-amine;hydrochloride |
| SMILES | C=CCNCC=C.Cl.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C6H11N.C4H4O4.ClH/c1-3-5-7-6-4-2;5-3(6)1-2-4(7)8;/h3-4,7H,1-2,5-6H2;1-2H,(H,5,6)(H,7,8);1H/b;2-1-; |
| InChIKey | PRNUWQMADDXBEU-FJOGWHKWSA-N |
| XLogP | 1.08 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.69 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;N-prop-2-enylprop-2-en-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;N-prop-2-enylprop-2-en-1-amine;hydrochloride?
The IUPAC name of (Z)-but-2-enedioic acid;N-prop-2-enylprop-2-en-1-amine;hydrochloride (CID 87270444) is (Z)-but-2-enedioic acid;N-prop-2-enylprop-2-en-1-amine;hydrochloride.
What is the SMILES notation for (Z)-but-2-enedioic acid;N-prop-2-enylprop-2-en-1-amine;hydrochloride?
The canonical SMILES for (Z)-but-2-enedioic acid;N-prop-2-enylprop-2-en-1-amine;hydrochloride is C=CCNCC=C.Cl.O=C(O)/C=C\C(=O)O.
What is the InChIKey of (Z)-but-2-enedioic acid;N-prop-2-enylprop-2-en-1-amine;hydrochloride?
The InChIKey is PRNUWQMADDXBEU-FJOGWHKWSA-N. The full InChI is InChI=1S/C6H11N.C4H4O4.ClH/c1-3-5-7-6-4-2;5-3(6)1-2-4(7)8;/h3-4,7H,1-2,5-6H2;1-2H,(H,5,6)(H,7,8);1H/b;2-1-;.
What are the key properties of (Z)-but-2-enedioic acid;N-prop-2-enylprop-2-en-1-amine;hydrochloride?
(Z)-but-2-enedioic acid;N-prop-2-enylprop-2-en-1-amine;hydrochloride has a molecular weight of 249.69 g/mol, XLogP of 1.08, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;N-prop-2-enylprop-2-en-1-amine;hydrochloride is sourced from PubChem (CID 87270444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).