C27H9F11N4 — CID 87270445
10-(2,3,4,5,6-pentafluorophenyl)-5,15-bis(trifluoromethyl)-21H-corrin (PubChem CID 87270445) has the molecular formula C27H9F11N4 and a molecular weight of 598.38 g/mol. Its IUPAC name is 10-(2,3,4,5,6-pentafluorophenyl)-5,15-bis(trifluoromethyl)-21H-corrin.
| Compound Name | 10-(2,3,4,5,6-pentafluorophenyl)-5,15-bis(trifluoromethyl)-21H-corrin |
|---|---|
| PubChem CID | 87270445 |
| Molecular Formula | C27H9F11N4 |
| Molecular Weight | 598.38 g/mol |
| Exact Mass | 598.07 |
| IUPAC Name | 10-(2,3,4,5,6-pentafluorophenyl)-5,15-bis(trifluoromethyl)-21H-corrin |
| SMILES | Fc1c(F)c(F)c(/C2=C3\C=CC(=N3)/C(C(F)(F)F)=c3/cc/c([nH]3)=C3\C=CC(=N3)/C(C(F)(F)F)=C3/C=CC2=N3)c(F)c1F |
| InChI | InChI=1S/C27H9F11N4/c28-21-18(22(29)24(31)25(32)23(21)30)17-11-3-7-15(41-11)19(26(33,34)35)13-5-1-9(39-13)10-2-6-14(40-10)20(27(36,37)38)16-8-4-12(17)42-16/h1-8,39H/b10-9-,17-11+,17-12+,19-13+,19-15+,20-14+,20-16+ |
| InChIKey | MQZIUGCKFIWTLM-GIYJOMJUSA-N |
| XLogP | 5.81 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.38 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|