C12H14N2O — CID 87270673
3-ethynyl-N-(oxan-4-yl)pyridin-2-amine (PubChem CID 87270673) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-ethynyl-N-(oxan-4-yl)pyridin-2-amine.
| Compound Name | 3-ethynyl-N-(oxan-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 87270673 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3-ethynyl-N-(oxan-4-yl)pyridin-2-amine |
| SMILES | C#Cc1cccnc1NC1CCOCC1 |
| InChI | InChI=1S/C12H14N2O/c1-2-10-4-3-7-13-12(10)14-11-5-8-15-9-6-11/h1,3-4,7,11H,5-6,8-9H2,(H,13,14) |
| InChIKey | YOPGTUKZQPACKR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|