C17H17N3 — CID 87270736
bicyclo[3.1.0]hexa-1(6),2,4-triene;N-cyclopentyl-4-ethynylpyrimidin-2-amine (PubChem CID 87270736) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;N-cyclopentyl-4-ethynylpyrimidin-2-amine.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;N-cyclopentyl-4-ethynylpyrimidin-2-amine |
|---|---|
| PubChem CID | 87270736 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;N-cyclopentyl-4-ethynylpyrimidin-2-amine |
| SMILES | C#Cc1ccnc(NC2CCCC2)n1.c1cc2cc-2c1 |
| InChI | InChI=1S/C11H13N3.C6H4/c1-2-9-7-8-12-11(13-9)14-10-5-3-4-6-10;1-2-5-4-6(5)3-1/h1,7-8,10H,3-6H2,(H,12,13,14);1-4H |
| InChIKey | KKMBAICDYRJSCZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|