C19H21ClF3NOS — CID 87271001
2-amino-5-[2-chloro-4-(2,4,5-trifluoro-3-methylphenyl)sulfanylphenyl]-2-methylpentan-1-ol (PubChem CID 87271001) has the molecular formula C19H21ClF3NOS and a molecular weight of 403.90 g/mol. Its IUPAC name is 2-amino-5-[2-chloro-4-(2,4,5-trifluoro-3-methylphenyl)sulfanylphenyl]-2-methylpentan-1-ol.
| Compound Name | 2-amino-5-[2-chloro-4-(2,4,5-trifluoro-3-methylphenyl)sulfanylphenyl]-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 87271001 |
| Molecular Formula | C19H21ClF3NOS |
| Molecular Weight | 403.90 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 2-amino-5-[2-chloro-4-(2,4,5-trifluoro-3-methylphenyl)sulfanylphenyl]-2-methylpentan-1-ol |
| SMILES | Cc1c(F)c(F)cc(Sc2ccc(CCCC(C)(N)CO)c(Cl)c2)c1F |
| InChI | InChI=1S/C19H21ClF3NOS/c1-11-17(22)15(21)9-16(18(11)23)26-13-6-5-12(14(20)8-13)4-3-7-19(2,24)10-25/h5-6,8-9,25H,3-4,7,10,24H2,1-2H3 |
| InChIKey | DQHVNCOPSCSUNL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.90 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|