C12H3BrCl6S2 — CID 87271159
1-[(4-bromo-2-chlorophenyl)disulfanyl]-2,3,4,5,6-pentachlorobenzene (PubChem CID 87271159) has the molecular formula C12H3BrCl6S2 and a molecular weight of 503.91 g/mol. Its IUPAC name is 1-[(4-bromo-2-chlorophenyl)disulfanyl]-2,3,4,5,6-pentachlorobenzene.
| Compound Name | 1-[(4-bromo-2-chlorophenyl)disulfanyl]-2,3,4,5,6-pentachlorobenzene |
|---|---|
| PubChem CID | 87271159 |
| Molecular Formula | C12H3BrCl6S2 |
| Molecular Weight | 503.91 g/mol |
| Exact Mass | 499.70 |
| IUPAC Name | 1-[(4-bromo-2-chlorophenyl)disulfanyl]-2,3,4,5,6-pentachlorobenzene |
| SMILES | Clc1cc(Br)ccc1SSc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H3BrCl6S2/c13-4-1-2-6(5(14)3-4)20-21-12-10(18)8(16)7(15)9(17)11(12)19/h1-3H |
| InChIKey | AMOOEECRNCEVTF-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.91 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|