About 3,5-dinitrobenzoic acid;4-methylbenzoic acid;pyridine-4-carboxamide
3,5-dinitrobenzoic acid;4-methylbenzoic acid;pyridine-4-carboxamide (PubChem CID 87271528) has the molecular formula C21H18N4O9
and a molecular weight of 470.39 g/mol. Its IUPAC name is 3,5-dinitrobenzoic acid;4-methylbenzoic acid;pyridine-4-carboxamide.
Molecular Properties
| Compound Name | 3,5-dinitrobenzoic acid;4-methylbenzoic acid;pyridine-4-carboxamide |
| PubChem CID | 87271528 |
| Molecular Formula | C21H18N4O9 |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 3,5-dinitrobenzoic acid;4-methylbenzoic acid;pyridine-4-carboxamide |
| SMILES | Cc1ccc(C(=O)O)cc1.NC(=O)c1ccncc1.O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H8O2.C7H4N2O6.C6H6N2O/c1-6-2-4-7(5-3-6)8(9)10;10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;7-6(9)5-1-3-8-4-2-5/h2-5H,1H3,(H,9,10);1-3H,(H,10,11);1-4H,(H2,7,9) |
| InChIKey | MMWNNMQGTZDGLF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 216.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dinitrobenzoic acid;4-methylbenzoic acid;pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dinitrobenzoic acid;4-methylbenzoic acid;pyridine-4-carboxamide?
The IUPAC name of 3,5-dinitrobenzoic acid;4-methylbenzoic acid;pyridine-4-carboxamide (CID 87271528) is 3,5-dinitrobenzoic acid;4-methylbenzoic acid;pyridine-4-carboxamide.
What is the SMILES notation for 3,5-dinitrobenzoic acid;4-methylbenzoic acid;pyridine-4-carboxamide?
The canonical SMILES for 3,5-dinitrobenzoic acid;4-methylbenzoic acid;pyridine-4-carboxamide is Cc1ccc(C(=O)O)cc1.NC(=O)c1ccncc1.O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.
What is the InChIKey of 3,5-dinitrobenzoic acid;4-methylbenzoic acid;pyridine-4-carboxamide?
The InChIKey is MMWNNMQGTZDGLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C7H4N2O6.C6H6N2O/c1-6-2-4-7(5-3-6)8(9)10;10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;7-6(9)5-1-3-8-4-2-5/h2-5H,1H3,(H,9,10);1-3H,(H,10,11);1-4H,(H2,7,9).
What are the key properties of 3,5-dinitrobenzoic acid;4-methylbenzoic acid;pyridine-4-carboxamide?
3,5-dinitrobenzoic acid;4-methylbenzoic acid;pyridine-4-carboxamide has a molecular weight of 470.39 g/mol, XLogP of 3.07, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dinitrobenzoic acid;4-methylbenzoic acid;pyridine-4-carboxamide is sourced from PubChem (CID 87271528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).