C31H36N2O11 — CID 87271666
[5-hydroxy-6-[3-[[4-hydroxy-3-(3-methylbut-2-enyl)benzoyl]amino]-8-methyl-2,4-dioxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate (PubChem CID 87271666) has the molecular formula C31H36N2O11 and a molecular weight of 612.63 g/mol. Its IUPAC name is [5-hydroxy-6-[3-[[4-hydroxy-3-(3-methylbut-2-enyl)benzoyl]amino]-8-methyl-2,4-dioxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate.
| Compound Name | [5-hydroxy-6-[3-[[4-hydroxy-3-(3-methylbut-2-enyl)benzoyl]amino]-8-methyl-2,4-dioxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
|---|---|
| PubChem CID | 87271666 |
| Molecular Formula | C31H36N2O11 |
| Molecular Weight | 612.63 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | [5-hydroxy-6-[3-[[4-hydroxy-3-(3-methylbut-2-enyl)benzoyl]amino]-8-methyl-2,4-dioxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
| SMILES | COC1C(OC(N)=O)C(O)C(Oc2ccc3c(c2C)OC(=O)C(NC(=O)c2ccc(O)c(CC=C(C)C)c2)C3=O)OC1(C)C |
| InChI | InChI=1S/C31H36N2O11/c1-14(2)7-8-16-13-17(9-11-19(16)34)27(37)33-21-22(35)18-10-12-20(15(3)24(18)42-28(21)38)41-29-23(36)25(43-30(32)39)26(40-6)31(4,5)44-29/h7,9-13,21,23,25-26,29,34,36H,8H2,1-6H3,(H2,32,39)(H,33,37) |
| InChIKey | NCRNFXDIIHROHW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 192.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.63 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|