About prop-2-enyl 2-oxopent-4-enoate
prop-2-enyl 2-oxopent-4-enoate (PubChem CID 87271748) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is prop-2-enyl 2-oxopent-4-enoate.
Molecular Properties
| Compound Name | prop-2-enyl 2-oxopent-4-enoate |
| PubChem CID | 87271748 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | prop-2-enyl 2-oxopent-4-enoate |
| SMILES | C=CCOC(=O)C(=O)CC=C |
| InChI | InChI=1S/C8H10O3/c1-3-5-7(9)8(10)11-6-4-2/h3-4H,1-2,5-6H2 |
| InChIKey | CBDCLZWRPDVPNV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 2-oxopent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 2-oxopent-4-enoate?
The IUPAC name of prop-2-enyl 2-oxopent-4-enoate (CID 87271748) is prop-2-enyl 2-oxopent-4-enoate.
What is the SMILES notation for prop-2-enyl 2-oxopent-4-enoate?
The canonical SMILES for prop-2-enyl 2-oxopent-4-enoate is C=CCOC(=O)C(=O)CC=C.
What is the InChIKey of prop-2-enyl 2-oxopent-4-enoate?
The InChIKey is CBDCLZWRPDVPNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-3-5-7(9)8(10)11-6-4-2/h3-4H,1-2,5-6H2.
What are the key properties of prop-2-enyl 2-oxopent-4-enoate?
prop-2-enyl 2-oxopent-4-enoate has a molecular weight of 154.16 g/mol, XLogP of 0.86, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2-oxopent-4-enoate is sourced from PubChem (CID 87271748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).