About (2E,4E)-hexa-2,4-dienoate;naphthalen-1-ylmethylazanium
(2E,4E)-hexa-2,4-dienoate;naphthalen-1-ylmethylazanium (PubChem CID 87272252) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is (2E,4E)-hexa-2,4-dienoate;naphthalen-1-ylmethylazanium.
Molecular Properties
| Compound Name | (2E,4E)-hexa-2,4-dienoate;naphthalen-1-ylmethylazanium |
| PubChem CID | 87272252 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (2E,4E)-hexa-2,4-dienoate;naphthalen-1-ylmethylazanium |
| SMILES | C/C=C/C=C/C(=O)[O-].[NH3+]Cc1cccc2ccccc12 |
| InChI | InChI=1S/C11H11N.C6H8O2/c12-8-10-6-3-5-9-4-1-2-7-11(9)10;1-2-3-4-5-6(7)8/h1-7H,8,12H2;2-5H,1H3,(H,7,8)/b;3-2+,5-4+ |
| InChIKey | KHLHVDGOJGACGA-PLKIVWSFSA-N |
| XLogP | 1.45 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-hexa-2,4-dienoate;naphthalen-1-ylmethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-hexa-2,4-dienoate;naphthalen-1-ylmethylazanium?
The IUPAC name of (2E,4E)-hexa-2,4-dienoate;naphthalen-1-ylmethylazanium (CID 87272252) is (2E,4E)-hexa-2,4-dienoate;naphthalen-1-ylmethylazanium.
What is the SMILES notation for (2E,4E)-hexa-2,4-dienoate;naphthalen-1-ylmethylazanium?
The canonical SMILES for (2E,4E)-hexa-2,4-dienoate;naphthalen-1-ylmethylazanium is C/C=C/C=C/C(=O)[O-].[NH3+]Cc1cccc2ccccc12.
What is the InChIKey of (2E,4E)-hexa-2,4-dienoate;naphthalen-1-ylmethylazanium?
The InChIKey is KHLHVDGOJGACGA-PLKIVWSFSA-N. The full InChI is InChI=1S/C11H11N.C6H8O2/c12-8-10-6-3-5-9-4-1-2-7-11(9)10;1-2-3-4-5-6(7)8/h1-7H,8,12H2;2-5H,1H3,(H,7,8)/b;3-2+,5-4+.
What are the key properties of (2E,4E)-hexa-2,4-dienoate;naphthalen-1-ylmethylazanium?
(2E,4E)-hexa-2,4-dienoate;naphthalen-1-ylmethylazanium has a molecular weight of 269.34 g/mol, XLogP of 1.45, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-hexa-2,4-dienoate;naphthalen-1-ylmethylazanium is sourced from PubChem (CID 87272252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).