C27H29N3O5Si — CID 87272387
methyl 6-(4-formylphenoxy)-2-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxylate (PubChem CID 87272387) has the molecular formula C27H29N3O5Si and a molecular weight of 503.63 g/mol. Its IUPAC name is methyl 6-(4-formylphenoxy)-2-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxylate.
| Compound Name | methyl 6-(4-formylphenoxy)-2-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 87272387 |
| Molecular Formula | C27H29N3O5Si |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | methyl 6-(4-formylphenoxy)-2-pyridin-2-yl-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1cc2nc(-c3ccccn3)n(COCC[Si](C)(C)C)c2cc1Oc1ccc(C=O)cc1 |
| InChI | InChI=1S/C27H29N3O5Si/c1-33-27(32)21-15-23-24(16-25(21)35-20-10-8-19(17-31)9-11-20)30(18-34-13-14-36(2,3)4)26(29-23)22-7-5-6-12-28-22/h5-12,15-17H,13-14,18H2,1-4H3 |
| InChIKey | PKACXECIJHAYTR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|