About bis[2,3,5-trichloro-6-(2-methylbutoxycarbonyl)phenyl] oxalate
bis[2,3,5-trichloro-6-(2-methylbutoxycarbonyl)phenyl] oxalate (PubChem CID 87272541) has the molecular formula C26H24Cl6O8
and a molecular weight of 677.19 g/mol. Its IUPAC name is bis[2,3,5-trichloro-6-(2-methylbutoxycarbonyl)phenyl] oxalate.
Molecular Properties
| Compound Name | bis[2,3,5-trichloro-6-(2-methylbutoxycarbonyl)phenyl] oxalate |
| PubChem CID | 87272541 |
| Molecular Formula | C26H24Cl6O8 |
| Molecular Weight | 677.19 g/mol |
| Exact Mass | 673.96 |
| IUPAC Name | bis[2,3,5-trichloro-6-(2-methylbutoxycarbonyl)phenyl] oxalate |
| SMILES | CCC(C)COC(=O)c1c(Cl)cc(Cl)c(Cl)c1OC(=O)C(=O)Oc1c(Cl)c(Cl)cc(Cl)c1C(=O)OCC(C)CC |
| InChI | InChI=1S/C26H24Cl6O8/c1-5-11(3)9-37-23(33)17-13(27)7-15(29)19(31)21(17)39-25(35)26(36)40-22-18(14(28)8-16(30)20(22)32)24(34)38-10-12(4)6-2/h7-8,11-12H,5-6,9-10H2,1-4H3 |
| InChIKey | YLQUPBDIEUIYIA-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 677.19 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis[2,3,5-trichloro-6-(2-methylbutoxycarbonyl)phenyl] oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2,3,5-trichloro-6-(2-methylbutoxycarbonyl)phenyl] oxalate?
The IUPAC name of bis[2,3,5-trichloro-6-(2-methylbutoxycarbonyl)phenyl] oxalate (CID 87272541) is bis[2,3,5-trichloro-6-(2-methylbutoxycarbonyl)phenyl] oxalate.
What is the SMILES notation for bis[2,3,5-trichloro-6-(2-methylbutoxycarbonyl)phenyl] oxalate?
The canonical SMILES for bis[2,3,5-trichloro-6-(2-methylbutoxycarbonyl)phenyl] oxalate is CCC(C)COC(=O)c1c(Cl)cc(Cl)c(Cl)c1OC(=O)C(=O)Oc1c(Cl)c(Cl)cc(Cl)c1C(=O)OCC(C)CC.
What is the InChIKey of bis[2,3,5-trichloro-6-(2-methylbutoxycarbonyl)phenyl] oxalate?
The InChIKey is YLQUPBDIEUIYIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24Cl6O8/c1-5-11(3)9-37-23(33)17-13(27)7-15(29)19(31)21(17)39-25(35)26(36)40-22-18(14(28)8-16(30)20(22)32)24(34)38-10-12(4)6-2/h7-8,11-12H,5-6,9-10H2,1-4H3.
What are the key properties of bis[2,3,5-trichloro-6-(2-methylbutoxycarbonyl)phenyl] oxalate?
bis[2,3,5-trichloro-6-(2-methylbutoxycarbonyl)phenyl] oxalate has a molecular weight of 677.19 g/mol, XLogP of 8.52, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2,3,5-trichloro-6-(2-methylbutoxycarbonyl)phenyl] oxalate is sourced from PubChem (CID 87272541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).