About bis[2-[(2-butan-2-ylcyclobutyl)methoxycarbonyl]-3,4,6-trichlorophenyl] oxalate
bis[2-[(2-butan-2-ylcyclobutyl)methoxycarbonyl]-3,4,6-trichlorophenyl] oxalate (PubChem CID 87273163) has the molecular formula C34H36Cl6O8
and a molecular weight of 785.37 g/mol. Its IUPAC name is bis[2-[(2-butan-2-ylcyclobutyl)methoxycarbonyl]-3,4,6-trichlorophenyl] oxalate.
Molecular Properties
| Compound Name | bis[2-[(2-butan-2-ylcyclobutyl)methoxycarbonyl]-3,4,6-trichlorophenyl] oxalate |
| PubChem CID | 87273163 |
| Molecular Formula | C34H36Cl6O8 |
| Molecular Weight | 785.37 g/mol |
| Exact Mass | 782.05 |
| IUPAC Name | bis[2-[(2-butan-2-ylcyclobutyl)methoxycarbonyl]-3,4,6-trichlorophenyl] oxalate |
| SMILES | CCC(C)C1CCC1COC(=O)c1c(Cl)c(Cl)cc(Cl)c1OC(=O)C(=O)Oc1c(Cl)cc(Cl)c(Cl)c1C(=O)OCC1CCC1C(C)CC |
| InChI | InChI=1S/C34H36Cl6O8/c1-5-15(3)19-9-7-17(19)13-45-31(41)25-27(39)21(35)11-23(37)29(25)47-33(43)34(44)48-30-24(38)12-22(36)28(40)26(30)32(42)46-14-18-8-10-20(18)16(4)6-2/h11-12,15-20H,5-10,13-14H2,1-4H3 |
| InChIKey | CMNHEVVVEJBJBI-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 785.37 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis[2-[(2-butan-2-ylcyclobutyl)methoxycarbonyl]-3,4,6-trichlorophenyl] oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-[(2-butan-2-ylcyclobutyl)methoxycarbonyl]-3,4,6-trichlorophenyl] oxalate?
The IUPAC name of bis[2-[(2-butan-2-ylcyclobutyl)methoxycarbonyl]-3,4,6-trichlorophenyl] oxalate (CID 87273163) is bis[2-[(2-butan-2-ylcyclobutyl)methoxycarbonyl]-3,4,6-trichlorophenyl] oxalate.
What is the SMILES notation for bis[2-[(2-butan-2-ylcyclobutyl)methoxycarbonyl]-3,4,6-trichlorophenyl] oxalate?
The canonical SMILES for bis[2-[(2-butan-2-ylcyclobutyl)methoxycarbonyl]-3,4,6-trichlorophenyl] oxalate is CCC(C)C1CCC1COC(=O)c1c(Cl)c(Cl)cc(Cl)c1OC(=O)C(=O)Oc1c(Cl)cc(Cl)c(Cl)c1C(=O)OCC1CCC1C(C)CC.
What is the InChIKey of bis[2-[(2-butan-2-ylcyclobutyl)methoxycarbonyl]-3,4,6-trichlorophenyl] oxalate?
The InChIKey is CMNHEVVVEJBJBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H36Cl6O8/c1-5-15(3)19-9-7-17(19)13-45-31(41)25-27(39)21(35)11-23(37)29(25)47-33(43)34(44)48-30-24(38)12-22(36)28(40)26(30)32(42)46-14-18-8-10-20(18)16(4)6-2/h11-12,15-20H,5-10,13-14H2,1-4H3.
What are the key properties of bis[2-[(2-butan-2-ylcyclobutyl)methoxycarbonyl]-3,4,6-trichlorophenyl] oxalate?
bis[2-[(2-butan-2-ylcyclobutyl)methoxycarbonyl]-3,4,6-trichlorophenyl] oxalate has a molecular weight of 785.37 g/mol, XLogP of 10.58, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-[(2-butan-2-ylcyclobutyl)methoxycarbonyl]-3,4,6-trichlorophenyl] oxalate is sourced from PubChem (CID 87273163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).