C23H31N3O5S3 — CID 87273186
N-[2-[1-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanylethyl]-2-hydroxybenzamide (PubChem CID 87273186) has the molecular formula C23H31N3O5S3 and a molecular weight of 525.72 g/mol. Its IUPAC name is N-[2-[1-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanylethyl]-2-hydroxybenzamide.
| Compound Name | N-[2-[1-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanylethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 87273186 |
| Molecular Formula | C23H31N3O5S3 |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | N-[2-[1-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanylethyl]-2-hydroxybenzamide |
| SMILES | O=C(CCCCC1CCSS1)NCCN1C(=O)CC(SCCNC(=O)c2ccccc2O)C1=O |
| InChI | InChI=1S/C23H31N3O5S3/c27-18-7-3-2-6-17(18)22(30)25-11-14-32-19-15-21(29)26(23(19)31)12-10-24-20(28)8-4-1-5-16-9-13-33-34-16/h2-3,6-7,16,19,27H,1,4-5,8-15H2,(H,24,28)(H,25,30) |
| InChIKey | OCXGLGPBRWBGKX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|