About bis(phenanthrene-2-carbonyl) piperazine-2,3-dicarboxylate
bis(phenanthrene-2-carbonyl) piperazine-2,3-dicarboxylate (PubChem CID 87273465) has the molecular formula C36H26N2O6
and a molecular weight of 582.61 g/mol. Its IUPAC name is bis(phenanthrene-2-carbonyl) piperazine-2,3-dicarboxylate.
Molecular Properties
| Compound Name | bis(phenanthrene-2-carbonyl) piperazine-2,3-dicarboxylate |
| PubChem CID | 87273465 |
| Molecular Formula | C36H26N2O6 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | bis(phenanthrene-2-carbonyl) piperazine-2,3-dicarboxylate |
| SMILES | O=C(OC(=O)C1NCCNC1C(=O)OC(=O)c1ccc2c(ccc3ccccc32)c1)c1ccc2c(ccc3ccccc32)c1 |
| InChI | InChI=1S/C36H26N2O6/c39-33(25-13-15-29-23(19-25)11-9-21-5-1-3-7-27(21)29)43-35(41)31-32(38-18-17-37-31)36(42)44-34(40)26-14-16-30-24(20-26)12-10-22-6-2-4-8-28(22)30/h1-16,19-20,31-32,37-38H,17-18H2 |
| InChIKey | RTMUAPZHXKMJPP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze bis(phenanthrene-2-carbonyl) piperazine-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(phenanthrene-2-carbonyl) piperazine-2,3-dicarboxylate?
The IUPAC name of bis(phenanthrene-2-carbonyl) piperazine-2,3-dicarboxylate (CID 87273465) is bis(phenanthrene-2-carbonyl) piperazine-2,3-dicarboxylate.
What is the SMILES notation for bis(phenanthrene-2-carbonyl) piperazine-2,3-dicarboxylate?
The canonical SMILES for bis(phenanthrene-2-carbonyl) piperazine-2,3-dicarboxylate is O=C(OC(=O)C1NCCNC1C(=O)OC(=O)c1ccc2c(ccc3ccccc32)c1)c1ccc2c(ccc3ccccc32)c1.
What is the InChIKey of bis(phenanthrene-2-carbonyl) piperazine-2,3-dicarboxylate?
The InChIKey is RTMUAPZHXKMJPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H26N2O6/c39-33(25-13-15-29-23(19-25)11-9-21-5-1-3-7-27(21)29)43-35(41)31-32(38-18-17-37-31)36(42)44-34(40)26-14-16-30-24(20-26)12-10-22-6-2-4-8-28(22)30/h1-16,19-20,31-32,37-38H,17-18H2.
What are the key properties of bis(phenanthrene-2-carbonyl) piperazine-2,3-dicarboxylate?
bis(phenanthrene-2-carbonyl) piperazine-2,3-dicarboxylate has a molecular weight of 582.61 g/mol, XLogP of 5.30, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(phenanthrene-2-carbonyl) piperazine-2,3-dicarboxylate is sourced from PubChem (CID 87273465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).