About 1-(3,3-difluorocyclopentyl)ethenyl trifluoromethanesulfonate
1-(3,3-difluorocyclopentyl)ethenyl trifluoromethanesulfonate (PubChem CID 87273716) has the molecular formula C8H9F5O3S
and a molecular weight of 280.21 g/mol. Its IUPAC name is 1-(3,3-difluorocyclopentyl)ethenyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1-(3,3-difluorocyclopentyl)ethenyl trifluoromethanesulfonate |
| PubChem CID | 87273716 |
| Molecular Formula | C8H9F5O3S |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 1-(3,3-difluorocyclopentyl)ethenyl trifluoromethanesulfonate |
| SMILES | C=C(OS(=O)(=O)C(F)(F)F)C1CCC(F)(F)C1 |
| InChI | InChI=1S/C8H9F5O3S/c1-5(6-2-3-7(9,10)4-6)16-17(14,15)8(11,12)13/h6H,1-4H2 |
| InChIKey | OGZPEJDFDQYYFT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-difluorocyclopentyl)ethenyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-difluorocyclopentyl)ethenyl trifluoromethanesulfonate?
The IUPAC name of 1-(3,3-difluorocyclopentyl)ethenyl trifluoromethanesulfonate (CID 87273716) is 1-(3,3-difluorocyclopentyl)ethenyl trifluoromethanesulfonate.
What is the SMILES notation for 1-(3,3-difluorocyclopentyl)ethenyl trifluoromethanesulfonate?
The canonical SMILES for 1-(3,3-difluorocyclopentyl)ethenyl trifluoromethanesulfonate is C=C(OS(=O)(=O)C(F)(F)F)C1CCC(F)(F)C1.
What is the InChIKey of 1-(3,3-difluorocyclopentyl)ethenyl trifluoromethanesulfonate?
The InChIKey is OGZPEJDFDQYYFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F5O3S/c1-5(6-2-3-7(9,10)4-6)16-17(14,15)8(11,12)13/h6H,1-4H2.
What are the key properties of 1-(3,3-difluorocyclopentyl)ethenyl trifluoromethanesulfonate?
1-(3,3-difluorocyclopentyl)ethenyl trifluoromethanesulfonate has a molecular weight of 280.21 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-difluorocyclopentyl)ethenyl trifluoromethanesulfonate is sourced from PubChem (CID 87273716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).