C26H34N6O5S — CID 87273768
2-[4-[4-[4-[3-(dimethylamino)propoxy]phenyl]cyclohexa-2,4-dien-1-yl]sulfonylpiperazin-1-yl]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 87273768) has the molecular formula C26H34N6O5S and a molecular weight of 542.66 g/mol. Its IUPAC name is 2-[4-[4-[4-[3-(dimethylamino)propoxy]phenyl]cyclohexa-2,4-dien-1-yl]sulfonylpiperazin-1-yl]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[4-[4-[4-[3-(dimethylamino)propoxy]phenyl]cyclohexa-2,4-dien-1-yl]sulfonylpiperazin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 87273768 |
| Molecular Formula | C26H34N6O5S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 2-[4-[4-[4-[3-(dimethylamino)propoxy]phenyl]cyclohexa-2,4-dien-1-yl]sulfonylpiperazin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | CN(C)CCCOc1ccc(C2=CCC(S(=O)(=O)N3CCN(c4ncc(C(=O)NO)cn4)CC3)C=C2)cc1 |
| InChI | InChI=1S/C26H34N6O5S/c1-30(2)12-3-17-37-23-8-4-20(5-9-23)21-6-10-24(11-7-21)38(35,36)32-15-13-31(14-16-32)26-27-18-22(19-28-26)25(33)29-34/h4-10,18-19,24,34H,3,11-17H2,1-2H3,(H,29,33) |
| InChIKey | JRJRIWGGNQAHFG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|