About 2,3-bis(prop-2-enyl)-1H-imidazol-3-ium;methanesulfonate
2,3-bis(prop-2-enyl)-1H-imidazol-3-ium;methanesulfonate (PubChem CID 87274291) has the molecular formula C10H16N2O3S
and a molecular weight of 244.32 g/mol. Its IUPAC name is 2,3-bis(prop-2-enyl)-1H-imidazol-3-ium;methanesulfonate.
Molecular Properties
| Compound Name | 2,3-bis(prop-2-enyl)-1H-imidazol-3-ium;methanesulfonate |
| PubChem CID | 87274291 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2,3-bis(prop-2-enyl)-1H-imidazol-3-ium;methanesulfonate |
| SMILES | C=CCc1[nH]cc[n+]1CC=C.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H12N2.CH4O3S/c1-3-5-9-10-6-8-11(9)7-4-2;1-5(2,3)4/h3-4,6,8H,1-2,5,7H2;1H3,(H,2,3,4) |
| InChIKey | GOGAUZGYSOPBLJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(prop-2-enyl)-1H-imidazol-3-ium;methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(prop-2-enyl)-1H-imidazol-3-ium;methanesulfonate?
The IUPAC name of 2,3-bis(prop-2-enyl)-1H-imidazol-3-ium;methanesulfonate (CID 87274291) is 2,3-bis(prop-2-enyl)-1H-imidazol-3-ium;methanesulfonate.
What is the SMILES notation for 2,3-bis(prop-2-enyl)-1H-imidazol-3-ium;methanesulfonate?
The canonical SMILES for 2,3-bis(prop-2-enyl)-1H-imidazol-3-ium;methanesulfonate is C=CCc1[nH]cc[n+]1CC=C.CS(=O)(=O)[O-].
What is the InChIKey of 2,3-bis(prop-2-enyl)-1H-imidazol-3-ium;methanesulfonate?
The InChIKey is GOGAUZGYSOPBLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2.CH4O3S/c1-3-5-9-10-6-8-11(9)7-4-2;1-5(2,3)4/h3-4,6,8H,1-2,5,7H2;1H3,(H,2,3,4).
What are the key properties of 2,3-bis(prop-2-enyl)-1H-imidazol-3-ium;methanesulfonate?
2,3-bis(prop-2-enyl)-1H-imidazol-3-ium;methanesulfonate has a molecular weight of 244.32 g/mol, XLogP of 0.38, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(prop-2-enyl)-1H-imidazol-3-ium;methanesulfonate is sourced from PubChem (CID 87274291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).