About dimethyl 7-iodo-5-(1-methylsulfonylethyl)pyrazolo[1,5-a]pyridine-2,3-dicarboxylate
dimethyl 7-iodo-5-(1-methylsulfonylethyl)pyrazolo[1,5-a]pyridine-2,3-dicarboxylate (PubChem CID 87274426) has the molecular formula C14H15IN2O6S
and a molecular weight of 466.25 g/mol. Its IUPAC name is dimethyl 7-iodo-5-(1-methylsulfonylethyl)pyrazolo[1,5-a]pyridine-2,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 7-iodo-5-(1-methylsulfonylethyl)pyrazolo[1,5-a]pyridine-2,3-dicarboxylate |
| PubChem CID | 87274426 |
| Molecular Formula | C14H15IN2O6S |
| Molecular Weight | 466.25 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | dimethyl 7-iodo-5-(1-methylsulfonylethyl)pyrazolo[1,5-a]pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)c1nn2c(I)cc(C(C)S(C)(=O)=O)cc2c1C(=O)OC |
| InChI | InChI=1S/C14H15IN2O6S/c1-7(24(4,20)21)8-5-9-11(13(18)22-2)12(14(19)23-3)16-17(9)10(15)6-8/h5-7H,1-4H3 |
| InChIKey | HCZNLBUBCKQVFY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 104.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 7-iodo-5-(1-methylsulfonylethyl)pyrazolo[1,5-a]pyridine-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 7-iodo-5-(1-methylsulfonylethyl)pyrazolo[1,5-a]pyridine-2,3-dicarboxylate?
The IUPAC name of dimethyl 7-iodo-5-(1-methylsulfonylethyl)pyrazolo[1,5-a]pyridine-2,3-dicarboxylate (CID 87274426) is dimethyl 7-iodo-5-(1-methylsulfonylethyl)pyrazolo[1,5-a]pyridine-2,3-dicarboxylate.
What is the SMILES notation for dimethyl 7-iodo-5-(1-methylsulfonylethyl)pyrazolo[1,5-a]pyridine-2,3-dicarboxylate?
The canonical SMILES for dimethyl 7-iodo-5-(1-methylsulfonylethyl)pyrazolo[1,5-a]pyridine-2,3-dicarboxylate is COC(=O)c1nn2c(I)cc(C(C)S(C)(=O)=O)cc2c1C(=O)OC.
What is the InChIKey of dimethyl 7-iodo-5-(1-methylsulfonylethyl)pyrazolo[1,5-a]pyridine-2,3-dicarboxylate?
The InChIKey is HCZNLBUBCKQVFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15IN2O6S/c1-7(24(4,20)21)8-5-9-11(13(18)22-2)12(14(19)23-3)16-17(9)10(15)6-8/h5-7H,1-4H3.
What are the key properties of dimethyl 7-iodo-5-(1-methylsulfonylethyl)pyrazolo[1,5-a]pyridine-2,3-dicarboxylate?
dimethyl 7-iodo-5-(1-methylsulfonylethyl)pyrazolo[1,5-a]pyridine-2,3-dicarboxylate has a molecular weight of 466.25 g/mol, XLogP of 1.62, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 7-iodo-5-(1-methylsulfonylethyl)pyrazolo[1,5-a]pyridine-2,3-dicarboxylate is sourced from PubChem (CID 87274426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).