C19H16N2O6 — CID 8727468
(2-benzamido-2-oxoethyl) 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate (PubChem CID 8727468) has the molecular formula C19H16N2O6 and a molecular weight of 368.35 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate.
| Compound Name | (2-benzamido-2-oxoethyl) 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
|---|---|
| PubChem CID | 8727468 |
| Molecular Formula | C19H16N2O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
| SMILES | O=C(COC(=O)CCn1c(=O)oc2ccccc21)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H16N2O6/c22-16(20-18(24)13-6-2-1-3-7-13)12-26-17(23)10-11-21-14-8-4-5-9-15(14)27-19(21)25/h1-9H,10-12H2,(H,20,22,24) |
| InChIKey | FMAPPXBAFVFDDS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |