About 3-[(3-amino-3-imino-2-methylpropyl)diazenyl]-2-methylpropanimidamide;sulfuric acid
3-[(3-amino-3-imino-2-methylpropyl)diazenyl]-2-methylpropanimidamide;sulfuric acid (PubChem CID 87274972) has the molecular formula C8H22N6O8S2
and a molecular weight of 394.43 g/mol. Its IUPAC name is 3-[(3-amino-3-imino-2-methylpropyl)diazenyl]-2-methylpropanimidamide;sulfuric acid.
Molecular Properties
| Compound Name | 3-[(3-amino-3-imino-2-methylpropyl)diazenyl]-2-methylpropanimidamide;sulfuric acid |
| PubChem CID | 87274972 |
| Molecular Formula | C8H22N6O8S2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 3-[(3-amino-3-imino-2-methylpropyl)diazenyl]-2-methylpropanimidamide;sulfuric acid |
| SMILES | O=S(=O)(O)O.O=S(=O)(O)O.[H]/N=C(\N)C(C)C/N=N/CC(C)/C(N)=N/[H] |
| InChI | InChI=1S/C8H18N6.2H2O4S/c1-5(7(9)10)3-13-14-4-6(2)8(11)12;2*1-5(2,3)4/h5-6H,3-4H2,1-2H3,(H3,9,10)(H3,11,12);2*(H2,1,2,3,4)/b14-13+;; |
| InChIKey | ROAGIXFBWFHNDG-QDBORUFSSA-N |
| XLogP | -0.72 |
| TPSA | 273.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3-amino-3-imino-2-methylpropyl)diazenyl]-2-methylpropanimidamide;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-amino-3-imino-2-methylpropyl)diazenyl]-2-methylpropanimidamide;sulfuric acid?
The IUPAC name of 3-[(3-amino-3-imino-2-methylpropyl)diazenyl]-2-methylpropanimidamide;sulfuric acid (CID 87274972) is 3-[(3-amino-3-imino-2-methylpropyl)diazenyl]-2-methylpropanimidamide;sulfuric acid.
What is the SMILES notation for 3-[(3-amino-3-imino-2-methylpropyl)diazenyl]-2-methylpropanimidamide;sulfuric acid?
The canonical SMILES for 3-[(3-amino-3-imino-2-methylpropyl)diazenyl]-2-methylpropanimidamide;sulfuric acid is O=S(=O)(O)O.O=S(=O)(O)O.[H]/N=C(\N)C(C)C/N=N/CC(C)/C(N)=N/[H].
What is the InChIKey of 3-[(3-amino-3-imino-2-methylpropyl)diazenyl]-2-methylpropanimidamide;sulfuric acid?
The InChIKey is ROAGIXFBWFHNDG-QDBORUFSSA-N. The full InChI is InChI=1S/C8H18N6.2H2O4S/c1-5(7(9)10)3-13-14-4-6(2)8(11)12;2*1-5(2,3)4/h5-6H,3-4H2,1-2H3,(H3,9,10)(H3,11,12);2*(H2,1,2,3,4)/b14-13+;;.
What are the key properties of 3-[(3-amino-3-imino-2-methylpropyl)diazenyl]-2-methylpropanimidamide;sulfuric acid?
3-[(3-amino-3-imino-2-methylpropyl)diazenyl]-2-methylpropanimidamide;sulfuric acid has a molecular weight of 394.43 g/mol, XLogP of -0.72, 6 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-amino-3-imino-2-methylpropyl)diazenyl]-2-methylpropanimidamide;sulfuric acid is sourced from PubChem (CID 87274972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).