C32H49ClO2 — CID 87275228
(4aS,6aR,6aS,6bR,12aS,14bS)-10-acetyl-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carbonyl chloride (PubChem CID 87275228) has the molecular formula C32H49ClO2 and a molecular weight of 501.20 g/mol. Its IUPAC name is (4aS,6aR,6aS,6bR,12aS,14bS)-10-acetyl-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carbonyl chloride.
| Compound Name | (4aS,6aR,6aS,6bR,12aS,14bS)-10-acetyl-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carbonyl chloride |
|---|---|
| PubChem CID | 87275228 |
| Molecular Formula | C32H49ClO2 |
| Molecular Weight | 501.20 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | (4aS,6aR,6aS,6bR,12aS,14bS)-10-acetyl-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carbonyl chloride |
| SMILES | CC(=O)C1CC[C@@]2(C)C(CC[C@]3(C)[C@@H]2CC=C2[C@@H]4CC(C)(C)CC[C@]4(C(=O)Cl)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C32H49ClO2/c1-20(34)21-11-13-29(6)24(28(21,4)5)12-14-31(8)25(29)10-9-22-23-19-27(2,3)15-17-32(23,26(33)35)18-16-30(22,31)7/h9,21,23-25H,10-19H2,1-8H3/t21?,23-,24?,25+,29-,30+,31+,32-/m0/s1 |
| InChIKey | UFZQDVGXGDQIPT-PKIPGRQQSA-N |
| XLogP | 8.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.20 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|