C37H26N4 — CID 87275252
5-(4-ethynylphenyl)-10-(2,4,6-trimethylphenyl)porphyrin (PubChem CID 87275252) has the molecular formula C37H26N4 and a molecular weight of 526.64 g/mol. Its IUPAC name is 5-(4-ethynylphenyl)-10-(2,4,6-trimethylphenyl)porphyrin.
| Compound Name | 5-(4-ethynylphenyl)-10-(2,4,6-trimethylphenyl)porphyrin |
|---|---|
| PubChem CID | 87275252 |
| Molecular Formula | C37H26N4 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 5-(4-ethynylphenyl)-10-(2,4,6-trimethylphenyl)porphyrin |
| SMILES | C#Cc1ccc(/C2=C3\C=CC(=N3)/C=C3/C=CC(=N3)/C=C3/C=CC(=N3)/C(c3c(C)cc(C)cc3C)=C3/C=CC2=N3)cc1 |
| InChI | InChI=1S/C37H26N4/c1-5-25-6-8-26(9-7-25)36-31-14-12-29(39-31)20-27-10-11-28(38-27)21-30-13-15-33(40-30)37(34-17-16-32(36)41-34)35-23(3)18-22(2)19-24(35)4/h1,6-21H,2-4H3/b27-20-,28-21-,29-20-,30-21-,36-31-,36-32-,37-33+,37-34+ |
| InChIKey | BDXCJOXIRBYFKB-JAVZAAAUSA-N |
| XLogP | 7.54 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|