About 1-methoxyheptalene
1-methoxyheptalene (PubChem CID 87275858) has the molecular formula C13H12O
and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-methoxyheptalene.
Molecular Properties
| Compound Name | 1-methoxyheptalene |
| PubChem CID | 87275858 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 1-methoxyheptalene |
| SMILES | COC1=CC=CC=C2C=CC=CC=C21 |
| InChI | InChI=1S/C13H12O/c1-14-13-10-6-5-8-11-7-3-2-4-9-12(11)13/h2-10H,1H3 |
| InChIKey | JMZFFIXDPKUUAH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methoxyheptalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyheptalene?
The IUPAC name of 1-methoxyheptalene (CID 87275858) is 1-methoxyheptalene.
What is the SMILES notation for 1-methoxyheptalene?
The canonical SMILES for 1-methoxyheptalene is COC1=CC=CC=C2C=CC=CC=C21.
What is the InChIKey of 1-methoxyheptalene?
The InChIKey is JMZFFIXDPKUUAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O/c1-14-13-10-6-5-8-11-7-3-2-4-9-12(11)13/h2-10H,1H3.
What are the key properties of 1-methoxyheptalene?
1-methoxyheptalene has a molecular weight of 184.24 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyheptalene is sourced from PubChem (CID 87275858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).