C33H14Br2F34 — CID 87276004
2,7-dibromo-9,9-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)fluorene (PubChem CID 87276004) has the molecular formula C33H14Br2F34 and a molecular weight of 1216.21 g/mol. Its IUPAC name is 2,7-dibromo-9,9-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)fluorene.
| Compound Name | 2,7-dibromo-9,9-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)fluorene |
|---|---|
| PubChem CID | 87276004 |
| Molecular Formula | C33H14Br2F34 |
| Molecular Weight | 1216.21 g/mol |
| Exact Mass | 1213.89 |
| IUPAC Name | 2,7-dibromo-9,9-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)fluorene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC1(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C33H14Br2F34/c34-11-1-3-13-14-4-2-12(35)10-16(14)17(15(13)9-11,5-7-18(36,37)20(40,41)22(44,45)24(48,49)26(52,53)28(56,57)30(60,61)32(64,65)66)6-8-19(38,39)21(42,43)23(46,47)25(50,51)27(54,55)29(58,59)31(62,63)33(67,68)69/h1-4,9-10H,5-8H2 |
| InChIKey | PMBHOVVLWMXHBZ-UHFFFAOYSA-N |
| XLogP | 17.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1216.21 |
| LogP ≤ 5 | 17.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|