About 2,3-dinitroquinoline
2,3-dinitroquinoline (PubChem CID 87276214) has the molecular formula C9H5N3O4
and a molecular weight of 219.16 g/mol. Its IUPAC name is 2,3-dinitroquinoline.
Molecular Properties
| Compound Name | 2,3-dinitroquinoline |
| PubChem CID | 87276214 |
| Molecular Formula | C9H5N3O4 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 2,3-dinitroquinoline |
| SMILES | O=[N+]([O-])c1cc2ccccc2nc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H5N3O4/c13-11(14)8-5-6-3-1-2-4-7(6)10-9(8)12(15)16/h1-5H |
| InChIKey | RRBUKOWICXHUHD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dinitroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dinitroquinoline?
The IUPAC name of 2,3-dinitroquinoline (CID 87276214) is 2,3-dinitroquinoline.
What is the SMILES notation for 2,3-dinitroquinoline?
The canonical SMILES for 2,3-dinitroquinoline is O=[N+]([O-])c1cc2ccccc2nc1[N+](=O)[O-].
What is the InChIKey of 2,3-dinitroquinoline?
The InChIKey is RRBUKOWICXHUHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N3O4/c13-11(14)8-5-6-3-1-2-4-7(6)10-9(8)12(15)16/h1-5H.
What are the key properties of 2,3-dinitroquinoline?
2,3-dinitroquinoline has a molecular weight of 219.16 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dinitroquinoline is sourced from PubChem (CID 87276214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).