C9H20ClN3O2 — CID 87276238
2-[bis(2-aminoethyl)amino]pent-4-enoic acid;hydrochloride (PubChem CID 87276238) has the molecular formula C9H20ClN3O2 and a molecular weight of 237.73 g/mol. Its IUPAC name is 2-[bis(2-aminoethyl)amino]pent-4-enoic acid;hydrochloride.
| Compound Name | 2-[bis(2-aminoethyl)amino]pent-4-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 87276238 |
| Molecular Formula | C9H20ClN3O2 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-[bis(2-aminoethyl)amino]pent-4-enoic acid;hydrochloride |
| SMILES | C=CCC(C(=O)O)N(CCN)CCN.Cl |
| InChI | InChI=1S/C9H19N3O2.ClH/c1-2-3-8(9(13)14)12(6-4-10)7-5-11;/h2,8H,1,3-7,10-11H2,(H,13,14);1H |
| InChIKey | QWTDWMNBNMCNMM-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|