C26H40O6 — CID 87276338
1,1-diethoxyethane;2-[(2,6-diethylphenoxy)methyl]benzaldehyde;ethane-1,2-diol (PubChem CID 87276338) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is 1,1-diethoxyethane;2-[(2,6-diethylphenoxy)methyl]benzaldehyde;ethane-1,2-diol.
| Compound Name | 1,1-diethoxyethane;2-[(2,6-diethylphenoxy)methyl]benzaldehyde;ethane-1,2-diol |
|---|---|
| PubChem CID | 87276338 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 1,1-diethoxyethane;2-[(2,6-diethylphenoxy)methyl]benzaldehyde;ethane-1,2-diol |
| SMILES | CCOC(C)OCC.CCc1cccc(CC)c1OCc1ccccc1C=O.OCCO |
| InChI | InChI=1S/C18H20O2.C6H14O2.C2H6O2/c1-3-14-10-7-11-15(4-2)18(14)20-13-17-9-6-5-8-16(17)12-19;1-4-7-6(3)8-5-2;3-1-2-4/h5-12H,3-4,13H2,1-2H3;6H,4-5H2,1-3H3;3-4H,1-2H2 |
| InChIKey | PIRAMLKYPWLFRQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|