C19H19NO4S — CID 87276459
(2-cyclohexa-1,5-dien-1-yl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanethione (PubChem CID 87276459) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is (2-cyclohexa-1,5-dien-1-yl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanethione.
| Compound Name | (2-cyclohexa-1,5-dien-1-yl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanethione |
|---|---|
| PubChem CID | 87276459 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (2-cyclohexa-1,5-dien-1-yl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanethione |
| SMILES | COc1cc(C(=S)c2coc(C3=CCCC=C3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C19H19NO4S/c1-21-15-9-13(10-16(22-2)17(15)23-3)18(25)14-11-24-19(20-14)12-7-5-4-6-8-12/h5,7-11H,4,6H2,1-3H3 |
| InChIKey | JHTKBFYJZHZEPR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|