About N-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexanamine
N-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexanamine (PubChem CID 87276544) has the molecular formula C8H13N3S2
and a molecular weight of 215.35 g/mol. Its IUPAC name is N-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexanamine.
Molecular Properties
| Compound Name | N-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexanamine |
| PubChem CID | 87276544 |
| Molecular Formula | C8H13N3S2 |
| Molecular Weight | 215.35 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | N-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexanamine |
| SMILES | c1nnc(SNC2CCCCC2)s1 |
| InChI | InChI=1S/C8H13N3S2/c1-2-4-7(5-3-1)11-13-8-10-9-6-12-8/h6-7,11H,1-5H2 |
| InChIKey | RSGPSQBZBZQCBL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexanamine?
The IUPAC name of N-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexanamine (CID 87276544) is N-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexanamine.
What is the SMILES notation for N-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexanamine?
The canonical SMILES for N-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexanamine is c1nnc(SNC2CCCCC2)s1.
What is the InChIKey of N-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexanamine?
The InChIKey is RSGPSQBZBZQCBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3S2/c1-2-4-7(5-3-1)11-13-8-10-9-6-12-8/h6-7,11H,1-5H2.
What are the key properties of N-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexanamine?
N-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexanamine has a molecular weight of 215.35 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexanamine is sourced from PubChem (CID 87276544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).