C14H16N5O7S+ — CID 87277061
(1S,5R)-2-[2-(3,4-dicarbamoylpyridin-1-ium-1-yl)acetyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid (PubChem CID 87277061) has the molecular formula C14H16N5O7S+ and a molecular weight of 398.38 g/mol. Its IUPAC name is (1S,5R)-2-[2-(3,4-dicarbamoylpyridin-1-ium-1-yl)acetyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid.
| Compound Name | (1S,5R)-2-[2-(3,4-dicarbamoylpyridin-1-ium-1-yl)acetyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
|---|---|
| PubChem CID | 87277061 |
| Molecular Formula | C14H16N5O7S+ |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | (1S,5R)-2-[2-(3,4-dicarbamoylpyridin-1-ium-1-yl)acetyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
| SMILES | NC(=O)c1cc[n+](CC(=O)N2CC[C@@H]3[C@H]2C(=O)N3S(=O)(=O)O)cc1C(N)=O |
| InChI | InChI=1S/C14H15N5O7S/c15-12(21)7-1-3-17(5-8(7)13(16)22)6-10(20)18-4-2-9-11(18)14(23)19(9)27(24,25)26/h1,3,5,9,11H,2,4,6H2,(H4-,15,16,21,22,24,25,26)/p+1/t9-,11+/m1/s1 |
| InChIKey | FEUGOVASQMPDPE-KOLCDFICSA-O |
| XLogP | -3.21 |
| TPSA | 185.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|