C21H29NO — CID 87277119
2-[(Z)-but-2-enyl]-6-but-3-enyl-4-[(2Z,4Z)-hepta-2,4,6-trienyl]-5-methyl-3-methylidene-1,4-oxazine (PubChem CID 87277119) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is 2-[(Z)-but-2-enyl]-6-but-3-enyl-4-[(2Z,4Z)-hepta-2,4,6-trienyl]-5-methyl-3-methylidene-1,4-oxazine.
| Compound Name | 2-[(Z)-but-2-enyl]-6-but-3-enyl-4-[(2Z,4Z)-hepta-2,4,6-trienyl]-5-methyl-3-methylidene-1,4-oxazine |
|---|---|
| PubChem CID | 87277119 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 2-[(Z)-but-2-enyl]-6-but-3-enyl-4-[(2Z,4Z)-hepta-2,4,6-trienyl]-5-methyl-3-methylidene-1,4-oxazine |
| SMILES | C=C/C=C\C=C/CN1C(=C)C(C/C=C\C)OC(CCC=C)=C1C |
| InChI | InChI=1S/C21H29NO/c1-6-9-12-13-14-17-22-18(4)20(15-10-7-2)23-21(19(22)5)16-11-8-3/h6-9,11-14,21H,1-2,5,10,15-17H2,3-4H3/b11-8-,12-9-,14-13- |
| InChIKey | VIDUYRMVCDMKRJ-AOFQWUNQSA-N |
| XLogP | 5.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|