C15H27NO4 — CID 87277156
2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 4-oxobutanoate (PubChem CID 87277156) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is 2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 4-oxobutanoate.
| Compound Name | 2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 4-oxobutanoate |
|---|---|
| PubChem CID | 87277156 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 4-oxobutanoate |
| SMILES | CC1(C)CC(O)CC(C)(C)N1CCOC(=O)CCC=O |
| InChI | InChI=1S/C15H27NO4/c1-14(2)10-12(18)11-15(3,4)16(14)7-9-20-13(19)6-5-8-17/h8,12,18H,5-7,9-11H2,1-4H3 |
| InChIKey | IMDCHDAPJKBSSW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|