About CID 87277234
CID 87277234 (PubChem CID 87277234) has the molecular formula C7H7BN2O2
and a molecular weight of 161.96 g/mol.
Molecular Properties
| Compound Name | CID 87277234 |
| PubChem CID | 87277234 |
| Molecular Formula | C7H7BN2O2 |
| Molecular Weight | 161.96 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | — |
| SMILES | [B]c1cc(N=O)c(N)c(OC)c1 |
| InChI | InChI=1S/C7H7BN2O2/c1-12-6-3-4(8)2-5(10-11)7(6)9/h2-3H,9H2,1H3 |
| InChIKey | VGXHSCZRIFHZRB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.96 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87277234 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87277234?
The IUPAC name of CID 87277234 (CID 87277234) is not available.
What is the SMILES notation for CID 87277234?
The canonical SMILES for CID 87277234 is [B]c1cc(N=O)c(N)c(OC)c1.
What is the InChIKey of CID 87277234?
The InChIKey is VGXHSCZRIFHZRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BN2O2/c1-12-6-3-4(8)2-5(10-11)7(6)9/h2-3H,9H2,1H3.
What are the key properties of CID 87277234?
CID 87277234 has a molecular weight of 161.96 g/mol, XLogP of 0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87277234 is sourced from PubChem (CID 87277234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).