C7H2F12 — CID 87277497
(E)-1,1,1,2,3,4,4,5,5,6,6,7-dodecafluorohept-2-ene (PubChem CID 87277497) has the molecular formula C7H2F12 and a molecular weight of 314.07 g/mol. Its IUPAC name is (E)-1,1,1,2,3,4,4,5,5,6,6,7-dodecafluorohept-2-ene.
| Compound Name | (E)-1,1,1,2,3,4,4,5,5,6,6,7-dodecafluorohept-2-ene |
|---|---|
| PubChem CID | 87277497 |
| Molecular Formula | C7H2F12 |
| Molecular Weight | 314.07 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | (E)-1,1,1,2,3,4,4,5,5,6,6,7-dodecafluorohept-2-ene |
| SMILES | FCC(F)(F)C(F)(F)C(F)(F)/C(F)=C(\F)C(F)(F)F |
| InChI | InChI=1S/C7H2F12/c8-1-4(11,12)7(18,19)5(13,14)2(9)3(10)6(15,16)17/h1H2/b3-2+ |
| InChIKey | CZMSONWYUBNNES-NSCUHMNNSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.07 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|