C8H6F13NS — CID 87277642
2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfanyl)ethanamine (PubChem CID 87277642) has the molecular formula C8H6F13NS and a molecular weight of 395.18 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfanyl)ethanamine.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 87277642 |
| Molecular Formula | C8H6F13NS |
| Molecular Weight | 395.18 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfanyl)ethanamine |
| SMILES | NCCSC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H6F13NS/c9-3(10,5(13,14)7(17,18)19)4(11,12)6(15,16)8(20,21)23-2-1-22/h1-2,22H2 |
| InChIKey | RKVXUSSSQDEUPG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.18 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|