C31H36ClN3O4SSi — CID 87277658
CID 87277658 (PubChem CID 87277658) has the molecular formula C31H36ClN3O4SSi and a molecular weight of 610.25 g/mol.
| Compound Name | CID 87277658 |
|---|---|
| PubChem CID | 87277658 |
| Molecular Formula | C31H36ClN3O4SSi |
| Molecular Weight | 610.25 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]C1(C)CCN([C@@H](c2cnc(NC(=O)C3(c4ccc5c(c4)OCO5)CC3)s2)c2ccccc2Cl)C1(C)O |
| InChI | InChI=1S/C31H36ClN3O4SSi/c1-28(2,3)41-29(4)14-15-35(30(29,5)37)25(20-8-6-7-9-21(20)32)24-17-33-27(40-24)34-26(36)31(12-13-31)19-10-11-22-23(16-19)39-18-38-22/h6-11,16-17,25,37H,12-15,18H2,1-5H3,(H,33,34,36)/t25-,29?,30?/m1/s1 |
| InChIKey | GZEBARLENMEZPC-WDEPAJCISA-N |
| XLogP | 6.80 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.25 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|