C13H19FN2O4S — CID 87278134
tert-butyl (3S,4S)-4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-fluoropiperidine-1-carboxylate (PubChem CID 87278134) has the molecular formula C13H19FN2O4S and a molecular weight of 318.37 g/mol. Its IUPAC name is tert-butyl (3S,4S)-4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 87278134 |
| Molecular Formula | C13H19FN2O4S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | tert-butyl (3S,4S)-4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](N2C(=O)CSC2=O)[C@@H](F)C1 |
| InChI | InChI=1S/C13H19FN2O4S/c1-13(2,3)20-11(18)15-5-4-9(8(14)6-15)16-10(17)7-21-12(16)19/h8-9H,4-7H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | ZGUAKFBJIDFEFD-IUCAKERBSA-N |
| XLogP | 2.03 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|