About phenacyl 2-phenylacetate
phenacyl 2-phenylacetate (PubChem CID 872782) has the molecular formula C16H14O3
and a molecular weight of 254.29 g/mol. Its IUPAC name is phenacyl 2-phenylacetate.
Molecular Properties
| Compound Name | phenacyl 2-phenylacetate |
| PubChem CID | 872782 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | phenacyl 2-phenylacetate |
| SMILES | O=C(Cc1ccccc1)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H14O3/c17-15(14-9-5-2-6-10-14)12-19-16(18)11-13-7-3-1-4-8-13/h1-10H,11-12H2 |
| InChIKey | YUVGYHKICRFUPB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenacyl 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacyl 2-phenylacetate?
The IUPAC name of phenacyl 2-phenylacetate (CID 872782) is phenacyl 2-phenylacetate.
What is the SMILES notation for phenacyl 2-phenylacetate?
The canonical SMILES for phenacyl 2-phenylacetate is O=C(Cc1ccccc1)OCC(=O)c1ccccc1.
What is the InChIKey of phenacyl 2-phenylacetate?
The InChIKey is YUVGYHKICRFUPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O3/c17-15(14-9-5-2-6-10-14)12-19-16(18)11-13-7-3-1-4-8-13/h1-10H,11-12H2.
What are the key properties of phenacyl 2-phenylacetate?
phenacyl 2-phenylacetate has a molecular weight of 254.29 g/mol, XLogP of 2.66, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl 2-phenylacetate is sourced from PubChem (CID 872782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).