C46H45F2N17O2 — CID 87278396
2,3-bis[4-[2-amino-8-(4-fluorophenyl)-7H-purin-6-yl]piperazin-1-yl]-N-methyl-N-phenyl-N'-pyridin-3-ylbutanediamide (PubChem CID 87278396) has the molecular formula C46H45F2N17O2 and a molecular weight of 905.98 g/mol. Its IUPAC name is 2,3-bis[4-[2-amino-8-(4-fluorophenyl)-7H-purin-6-yl]piperazin-1-yl]-N-methyl-N-phenyl-N'-pyridin-3-ylbutanediamide.
| Compound Name | 2,3-bis[4-[2-amino-8-(4-fluorophenyl)-7H-purin-6-yl]piperazin-1-yl]-N-methyl-N-phenyl-N'-pyridin-3-ylbutanediamide |
|---|---|
| PubChem CID | 87278396 |
| Molecular Formula | C46H45F2N17O2 |
| Molecular Weight | 905.98 g/mol |
| Exact Mass | 905.39 |
| IUPAC Name | 2,3-bis[4-[2-amino-8-(4-fluorophenyl)-7H-purin-6-yl]piperazin-1-yl]-N-methyl-N-phenyl-N'-pyridin-3-ylbutanediamide |
| SMILES | CN(C(=O)C(C(C(=O)Nc1cccnc1)N1CCN(c2nc(N)nc3nc(-c4ccc(F)cc4)[nH]c23)CC1)N1CCN(c2nc(N)nc3nc(-c4ccc(F)cc4)[nH]c23)CC1)c1ccccc1 |
| InChI | InChI=1S/C46H45F2N17O2/c1-61(32-7-3-2-4-8-32)44(67)36(63-20-24-65(25-21-63)42-34-40(58-46(50)60-42)56-38(54-34)28-11-15-30(48)16-12-28)35(43(66)52-31-6-5-17-51-26-31)62-18-22-64(23-19-62)41-33-39(57-45(49)59-41)55-37(53-33)27-9-13-29(47)14-10-27/h2-17,26,35-36H,18-25H2,1H3,(H,52,66)(H3,49,53,55,57,59)(H3,50,54,56,58,60) |
| InChIKey | SRCBPYVPLBSDLH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 236.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.98 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |