C13H2F6N2 — CID 87278518
2-(1,3,4,5,6,6-hexafluoronaphthalen-2-ylidene)propanedinitrile (PubChem CID 87278518) has the molecular formula C13H2F6N2 and a molecular weight of 300.16 g/mol. Its IUPAC name is 2-(1,3,4,5,6,6-hexafluoronaphthalen-2-ylidene)propanedinitrile.
| Compound Name | 2-(1,3,4,5,6,6-hexafluoronaphthalen-2-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 87278518 |
| Molecular Formula | C13H2F6N2 |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 2-(1,3,4,5,6,6-hexafluoronaphthalen-2-ylidene)propanedinitrile |
| SMILES | N#CC(C#N)=c1c(F)c(F)c2c(c1F)C=CC(F)(F)C=2F |
| InChI | InChI=1S/C13H2F6N2/c14-9-6-1-2-13(18,19)12(17)8(6)11(16)10(15)7(9)5(3-20)4-21/h1-2H |
| InChIKey | HYQRILCXPDKYAU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|