C9H13FN2O2S — CID 87278539
3-[(3R,4R)-3-fluoro-1-methylpiperidin-4-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 87278539) has the molecular formula C9H13FN2O2S and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-[(3R,4R)-3-fluoro-1-methylpiperidin-4-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(3R,4R)-3-fluoro-1-methylpiperidin-4-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87278539 |
| Molecular Formula | C9H13FN2O2S |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 3-[(3R,4R)-3-fluoro-1-methylpiperidin-4-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | CN1CC[C@@H](N2C(=O)CSC2=O)[C@H](F)C1 |
| InChI | InChI=1S/C9H13FN2O2S/c1-11-3-2-7(6(10)4-11)12-8(13)5-15-9(12)14/h6-7H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | AYNIHJLRZLJOSD-RNFRBKRXSA-N |
| XLogP | 0.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|