About 1-amino-3-(1,2,2-trifluoroethyl)urea
1-amino-3-(1,2,2-trifluoroethyl)urea (PubChem CID 87278645) has the molecular formula C3H6F3N3O
and a molecular weight of 157.10 g/mol. Its IUPAC name is 1-amino-3-(1,2,2-trifluoroethyl)urea.
Molecular Properties
| Compound Name | 1-amino-3-(1,2,2-trifluoroethyl)urea |
| PubChem CID | 87278645 |
| Molecular Formula | C3H6F3N3O |
| Molecular Weight | 157.10 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | 1-amino-3-(1,2,2-trifluoroethyl)urea |
| SMILES | NNC(=O)NC(F)C(F)F |
| InChI | InChI=1S/C3H6F3N3O/c4-1(5)2(6)8-3(10)9-7/h1-2H,7H2,(H2,8,9,10) |
| InChIKey | MQCKSURUHQHHLU-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.10 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-(1,2,2-trifluoroethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(1,2,2-trifluoroethyl)urea?
The IUPAC name of 1-amino-3-(1,2,2-trifluoroethyl)urea (CID 87278645) is 1-amino-3-(1,2,2-trifluoroethyl)urea.
What is the SMILES notation for 1-amino-3-(1,2,2-trifluoroethyl)urea?
The canonical SMILES for 1-amino-3-(1,2,2-trifluoroethyl)urea is NNC(=O)NC(F)C(F)F.
What is the InChIKey of 1-amino-3-(1,2,2-trifluoroethyl)urea?
The InChIKey is MQCKSURUHQHHLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6F3N3O/c4-1(5)2(6)8-3(10)9-7/h1-2H,7H2,(H2,8,9,10).
What are the key properties of 1-amino-3-(1,2,2-trifluoroethyl)urea?
1-amino-3-(1,2,2-trifluoroethyl)urea has a molecular weight of 157.10 g/mol, XLogP of -0.28, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(1,2,2-trifluoroethyl)urea is sourced from PubChem (CID 87278645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).